Products 2209086-94-0
CAS 2209086-94-0 is the registry number for 4-Benzyl 1-(tert-butyl) (r)-2-((r)-1-hydroxyethyl)piperazine-1,4-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-O-benzyl 1-O-tert-butyl (2R)-2-[(1R)-1-hydroxyethyl]piperazine-1,4-dicarboxylate (CAS 2209086-94-0) is a chemical compound with the molecular formula C19H28N2O5 and a molecular weight of 364.4 g/mol. IUPAC name: 4-O-benzyl 1-O-tert-butyl (2R)-2-[(1R)-1-hydroxyethyl]piperazine-1,4-dicarboxylate. InChIKey: LTXNDRMMTRTOJG-GDBMZVCRSA-N.
| Molecular formula | C19H28N2O5 |
|---|---|
| Molecular weight | 364.4 g/mol |
| IUPAC name | 4-O-benzyl 1-O-tert-butyl (2R)-2-[(1R)-1-hydroxyethyl]piperazine-1,4-dicarboxylate |
| InChIKey | LTXNDRMMTRTOJG-GDBMZVCRSA-N |
| SMILES | C[C@H]([C@H]1CN(CCN1C(=O)OC(C)(C)C)C(=O)OCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)