Products 1165-03-3
CAS 1165-03-3 is the registry number for 2,2'-Dimethyl-[1,1'-binaphthalene]-4,4'-diamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(4-amino-2-methylnaphthalen-1-yl)-3-methylnaphthalen-1-amine (CAS 1165-03-3) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: 4-(4-amino-2-methylnaphthalen-1-yl)-3-methylnaphthalen-1-amine. InChIKey: CDWFXBFECPICQI-UHFFFAOYSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 4-(4-amino-2-methylnaphthalen-1-yl)-3-methylnaphthalen-1-amine |
| InChIKey | CDWFXBFECPICQI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C(=C1)N)C3=C(C=C(C4=CC=CC=C43)N)C |
Computed by PubChem (NCBI)