CAS 677723-24-9 appears in our catalog under these names: (1R,2R)-1,2-Di(naphthalen-1-yl)ethane-1,2-diamine, 97%, (1R,2R)-1,2-di(naphthalen-1-yl)ethane-1,2-diamine, 95%, 95%, (1R,2R)-1,2-di(naphthalen-1-yl)ethane-1,2-diamine, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 100mg, 1g.
(1R,2R)-1,2-dinaphthalen-1-ylethane-1,2-diamine (CAS 677723-24-9) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: (1R,2R)-1,2-dinaphthalen-1-ylethane-1,2-diamine. InChIKey: VVJVMUUCGDSHBT-FGZHOGPDSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (1R,2R)-1,2-dinaphthalen-1-ylethane-1,2-diamine |
| InChIKey | VVJVMUUCGDSHBT-FGZHOGPDSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2[C@H]([C@@H](C3=CC=CC4=CC=CC=C43)N)N |
Computed by PubChem (NCBI)