CAS 13924-53-3 is the registry number for N-(4-(Dimethylamino)benzylidene)-9H-fluoren-2-amine, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(9H-fluoren-2-yliminomethyl)-N,N-dimethylaniline (CAS 13924-53-3) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: 4-(9H-fluoren-2-yliminomethyl)-N,N-dimethylaniline. InChIKey: YUKPSVJYPSYVLB-UHFFFAOYSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | 4-(9H-fluoren-2-yliminomethyl)-N,N-dimethylaniline |
| InChIKey | YUKPSVJYPSYVLB-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C=NC2=CC3=C(C=C2)C4=CC=CC=C4C3 |
Computed by PubChem (NCBI)