CAS 885218-37-1 is the registry number for (4R,5R)-4,5-Dihydro-2-(4-methylphenyl)-4,5-diphenyl-1H-imidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
(4R,5R)-2-(4-methylphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole (CAS 885218-37-1) is a chemical compound with the molecular formula C22H20N2 and a molecular weight of 312.4 g/mol. IUPAC name: (4R,5R)-2-(4-methylphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole. InChIKey: MDFIEKJYKFRKLJ-NHCUHLMSSA-N.
| Molecular formula | C22H20N2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (4R,5R)-2-(4-methylphenyl)-4,5-diphenyl-4,5-dihydro-1H-imidazole |
| InChIKey | MDFIEKJYKFRKLJ-NHCUHLMSSA-N |
| SMILES | CC1=CC=C(C=C1)C2=N[C@@H]([C@H](N2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)