Products 116505-53-4
CAS 116505-53-4 appears in our catalog under these names: 4-(4-((2-Chloroethyl)amino)phenyl)butanoic acid, 98%, Chlorambucil EP Impurity B, Chlorambucil Impurity 2 (Chlorambucil EP Impurity B), N-Des-(2-chloroethyl) Chlorambucil, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[4-(2-chloroethylamino)phenyl]butanoic acid (CAS 116505-53-4) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: 4-[4-(2-chloroethylamino)phenyl]butanoic acid. InChIKey: JKJKVYIHGWHFSO-UHFFFAOYSA-N.
| Molecular formula | C12H16ClNO2 |
|---|---|
| Molecular weight | 241.71 g/mol |
| IUPAC name | 4-[4-(2-chloroethylamino)phenyl]butanoic acid |
| InChIKey | JKJKVYIHGWHFSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CCCC(=O)O)NCCCl |
Computed by PubChem (NCBI)
Synonyms:
Chlorambucil half mustard, Monochloroethyl chlorambucil, 4-((2-Chloroethyl)amino)benzenebutanoic acid, Benzenebutanoic acid, 4-((2-chloroethyl)amino)-, Chlorambucil EP Impurity B, 4-[4-(2-chloroethylamino)phenyl]butanoic acid, Chlorambucil half-mustard, N-Des-(2-chloroethyl) Chlorambucil, 4-{4-[(2-chloroethyl)amino]phenyl}butanoic acid, CHLORAMBUCIL IMPURITY B [EP IMPURITY]