CAS 116599-62-3 is the registry number for O-XYLENE-DIMETHYL-13C2 99 ATOM % 13C. Offered by: Sigma-Aldrich. Available pack sizes: 1G.
1,2-di((113C)methyl)benzene (CAS 116599-62-3) is a chemical compound with the molecular formula C8H10 and a molecular weight of 108.15 g/mol. IUPAC name: 1,2-di((113C)methyl)benzene. InChIKey: CTQNGGLPUBDAKN-ZDOIIHCHSA-N.
| Molecular formula | C8H10 |
|---|---|
| Molecular weight | 108.15 g/mol |
| IUPAC name | 1,2-di((113C)methyl)benzene |
| InChIKey | CTQNGGLPUBDAKN-ZDOIIHCHSA-N |
| SMILES | [13CH3]C1=CC=CC=C1[13CH3] |
Computed by PubChem (NCBI)