Products 25319-54-4
CAS 25319-54-4 appears in our catalog under these names: o-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6, o-Xylene-alpha,alpha,alpha,alpha',alpha',alpha'-d6, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 100mg, 10mg, 50mg, 1g.
1,2-bis(trideuteriomethyl)benzene (CAS 25319-54-4) is a chemical compound with the molecular formula C8H10 and a molecular weight of 112.20 g/mol. IUPAC name: 1,2-bis(trideuteriomethyl)benzene. InChIKey: CTQNGGLPUBDAKN-WFGJKAKNSA-N.
| Molecular formula | C8H10 |
|---|---|
| Molecular weight | 112.20 g/mol |
| IUPAC name | 1,2-bis(trideuteriomethyl)benzene |
| InChIKey | CTQNGGLPUBDAKN-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])C1=CC=CC=C1C([2H])([2H])[2H] |
Computed by PubChem (NCBI)