CAS 1403579-63-4 is the registry number for Ethylbenzene-13C6. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Ethyl(1,2,3,4,5,6-13C6)cyclohexatriene (CAS 1403579-63-4) is a chemical compound with the molecular formula C8H10 and a molecular weight of 112.12 g/mol. IUPAC name: ethyl(1,2,3,4,5,6-13C6)cyclohexatriene. InChIKey: YNQLUTRBYVCPMQ-LSYAIDEBSA-N.
| Molecular formula | C8H10 |
|---|---|
| Molecular weight | 112.12 g/mol |
| IUPAC name | ethyl(1,2,3,4,5,6-13C6)cyclohexatriene |
| InChIKey | YNQLUTRBYVCPMQ-LSYAIDEBSA-N |
| SMILES | CC[13C]1=[13CH][13CH]=[13CH][13CH]=[13CH]1 |
Computed by PubChem (NCBI)