Products 2667018-29-1
CAS 2667018-29-1 is the registry number for (S)-3-(3-Oxo-3,4-dihydropyrrolo[3,4-b]indol-2(1H)-yl)piperidine-2,6-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S)-3-(3-oxo-1,4-dihydropyrrolo[3,4-b]indol-2-yl)piperidine-2,6-dione (CAS 2667018-29-1) is a chemical compound with the molecular formula C15H13N3O3 and a molecular weight of 283.28 g/mol. IUPAC name: (3S)-3-(3-oxo-1,4-dihydropyrrolo[3,4-b]indol-2-yl)piperidine-2,6-dione. InChIKey: LXAFOOLLGXEVBH-NSHDSACASA-N.
| Molecular formula | C15H13N3O3 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | (3S)-3-(3-oxo-1,4-dihydropyrrolo[3,4-b]indol-2-yl)piperidine-2,6-dione |
| InChIKey | LXAFOOLLGXEVBH-NSHDSACASA-N |
| SMILES | C1CC(=O)NC(=O)[C@H]1N2CC3=C(C2=O)NC4=CC=CC=C34 |
Computed by PubChem (NCBI)