Products 116668-47-4
CAS 116668-47-4 appears in our catalog under these names: 6–Amino–2–naphthoic acid, 6-Amino-2-naphthoic Acid, >97.0%(HPLC)(T), 6-Amino-2-naphthoic acid, 90%, 6-Amino-2-naphthoic acid 97%, 6-Amino-2-naphthoic acid, 97%, 97%. Offered by: GLPBio, TCI, Thermo Scientific (Acros), Ambeed, Sigma-Aldrich. Available pack sizes: 10g, 25g, 50g, 5g, 250mg, 1g, 100g.
6-aminonaphthalene-2-carboxylic acid (CAS 116668-47-4) is a chemical compound with the molecular formula C11H9NO2 and a molecular weight of 187.19 g/mol. IUPAC name: 6-aminonaphthalene-2-carboxylic acid. InChIKey: NZTPZUIIYNYZKT-UHFFFAOYSA-N.
| Molecular formula | C11H9NO2 |
|---|---|
| Molecular weight | 187.19 g/mol |
| IUPAC name | 6-aminonaphthalene-2-carboxylic acid |
| InChIKey | NZTPZUIIYNYZKT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)N)C=C1C(=O)O |
Computed by PubChem (NCBI)