Products 1166820-45-6

CAS 1166820-45-6 is the registry number for Methyl 3-(pyrrolidin-3-yl)benzoate hcl, 95%. Offered by: AmBeed. Available pack sizes: 1g, 250mg.

Methyl 3-pyrrolidin-3-ylbenzoate;hydrochloride (CAS 1166820-45-6) is a chemical compound with the molecular formula C12H16ClNO2 and a molecular weight of 241.71 g/mol. IUPAC name: methyl 3-pyrrolidin-3-ylbenzoate;hydrochloride. InChIKey: YZCGXCMORJXHDJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H16ClNO2
Molecular weight241.71 g/mol
IUPAC namemethyl 3-pyrrolidin-3-ylbenzoate;hydrochloride
InChIKeyYZCGXCMORJXHDJ-UHFFFAOYSA-N
SMILESCOC(=O)C1=CC=CC(=C1)C2CCNC2.Cl

Computed by PubChem (NCBI)