CAS 1167414-88-1 appears in our catalog under these names: (R)-1-(m-Tolyl)ethanamine hydrochloride, 97%, (R)-1-(m-Tolyl)ethanamine hydrochloride, 95%, (R)-1-(m-Tolyl)ethanamine hydrochloride, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 2.5g, 5g, 10g.
(1R)-1-(3-methylphenyl)ethanamine;hydrochloride (CAS 1167414-88-1) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. IUPAC name: (1R)-1-(3-methylphenyl)ethanamine;hydrochloride. InChIKey: UGZRFRLOFJGHSK-DDWIOCJRSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 171.67 g/mol |
| IUPAC name | (1R)-1-(3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | UGZRFRLOFJGHSK-DDWIOCJRSA-N |
| SMILES | CC1=CC(=CC=C1)[C@@H](C)N.Cl |
Computed by PubChem (NCBI)