CAS 1630984-18-7 appears in our catalog under these names: (S)–1–(m–Tolyl)ethanamine hydrochloride, (1S)-1-(3-Methylphenyl)ethan-1-amine hydrochloride, (S)-1-(m-Tolyl)ethanamine hydrochloride, 97%, 97%, (S)-1-m-Tolylethanamine hydrochloride, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 500mg, 2.5g.
(1S)-1-(3-methylphenyl)ethanamine;hydrochloride (CAS 1630984-18-7) is a chemical compound with the molecular formula C9H14ClN and a molecular weight of 171.67 g/mol. IUPAC name: (1S)-1-(3-methylphenyl)ethanamine;hydrochloride. InChIKey: UGZRFRLOFJGHSK-QRPNPIFTSA-N.
| Molecular formula | C9H14ClN |
|---|---|
| Molecular weight | 171.67 g/mol |
| IUPAC name | (1S)-1-(3-methylphenyl)ethanamine;hydrochloride |
| InChIKey | UGZRFRLOFJGHSK-QRPNPIFTSA-N |
| SMILES | CC1=CC(=CC=C1)[C@H](C)N.Cl |
Computed by PubChem (NCBI)