CAS 1167414-91-6 appears in our catalog under these names: (1R)-1-(3-Bromophenyl)ethanamine hydrochloride, 95%, (R)-1-(3-Bromophenyl)ethanamine hydrochloride, 98%, (R)–1–(3–Bromophenyl)ethanamine hydrochloride, (R)-1-(3-Bromophenyl)ethanamine hydrochloride, 98%, 98%, (R)-1-(3-BROMOPHENYL)ETHANAMINE HCL, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 25g, 100mg, 10g.
(1R)-1-(3-bromophenyl)ethanamine;hydrochloride (CAS 1167414-91-6) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1R)-1-(3-bromophenyl)ethanamine;hydrochloride. InChIKey: JEZBIRPQFCGDRY-FYZOBXCZSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1R)-1-(3-bromophenyl)ethanamine;hydrochloride |
| InChIKey | JEZBIRPQFCGDRY-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)