CAS 2172274-44-9 appears in our catalog under these names: (S)-(-)-3-Bromo-alpha-methylbenzylamine hydrochloride, 95%, (S)–1–(3–Bromophenyl)ethanamine hydrochloride, (S)-1-(3-Bromophenyl)ethanamine hydrochloride, 95%, 95%, (S)-1-(3-Bromophenyl)ethanamine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
(1S)-1-(3-bromophenyl)ethanamine;hydrochloride (CAS 2172274-44-9) is a chemical compound with the molecular formula C8H11BrClN and a molecular weight of 236.53 g/mol. IUPAC name: (1S)-1-(3-bromophenyl)ethanamine;hydrochloride. InChIKey: JEZBIRPQFCGDRY-RGMNGODLSA-N.
| Molecular formula | C8H11BrClN |
|---|---|
| Molecular weight | 236.53 g/mol |
| IUPAC name | (1S)-1-(3-bromophenyl)ethanamine;hydrochloride |
| InChIKey | JEZBIRPQFCGDRY-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)Br)N.Cl |
Computed by PubChem (NCBI)