CAS 1167416-21-8 appears in our catalog under these names: tert-Butyl 8-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-4-carboxylate, 95%, tert-Butyl 8-hydroxy-2,3,4,5-tetrahydro-1,4-benzoxazepine-4-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 8-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate (CAS 1167416-21-8) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: tert-butyl 8-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate. InChIKey: POYYOUNCWNYTEJ-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | tert-butyl 8-hydroxy-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate |
| InChIKey | POYYOUNCWNYTEJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=CC(=C2)O |
Computed by PubChem (NCBI)