CAS 116753-51-6 appears in our catalog under these names: 3-(3-Nitrophenoxy)propan-1-amine 95%, 3-(3-Nitrophenoxy)propan-1-amine, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-(3-nitrophenoxy)propan-1-amine (CAS 116753-51-6) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 3-(3-nitrophenoxy)propan-1-amine. InChIKey: QMRSDYBQUDEVCQ-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 3-(3-nitrophenoxy)propan-1-amine |
| InChIKey | QMRSDYBQUDEVCQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCCCN)[N+](=O)[O-] |
Computed by PubChem (NCBI)