CAS 116757-91-6 appears in our catalog under these names: 2,2,2-Trifluoro-1-(1-methyl-1h-indol-3-yl)-1-ethanol, 95%, 2,2,2-Trifluoro-1-(1-methyl-1H-indol-3-yl)ethan-1-ol 95+%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
2,2,2-trifluoro-1-(1-methylindol-3-yl)ethanol (CAS 116757-91-6) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: 2,2,2-trifluoro-1-(1-methylindol-3-yl)ethanol. InChIKey: ARPIRHUPDYIDHC-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(1-methylindol-3-yl)ethanol |
| InChIKey | ARPIRHUPDYIDHC-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(C(F)(F)F)O |
Computed by PubChem (NCBI)