CAS 125290-72-4 appears in our catalog under these names: 2-(2,4,5-Trifluorophenyl)-4,5-dihydro-4,4-dimethyloxazole, 95%, 4,4-Dimethyl-2-(2,4,5-trifluorophenyl)-4,5-dihydrooxazole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
4,4-dimethyl-2-(2,4,5-trifluorophenyl)-5H-1,3-oxazole (CAS 125290-72-4) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: 4,4-dimethyl-2-(2,4,5-trifluorophenyl)-5H-1,3-oxazole. InChIKey: QNTYWFRSDUCLRD-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | 4,4-dimethyl-2-(2,4,5-trifluorophenyl)-5H-1,3-oxazole |
| InChIKey | QNTYWFRSDUCLRD-UHFFFAOYSA-N |
| SMILES | CC1(COC(=N1)C2=CC(=C(C=C2F)F)F)C |
Computed by PubChem (NCBI)