CAS 134219-70-8 is the registry number for (3E)-4-(Benzylamino)-1,1,1-trifluorobut-3-en-2-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(E)-4-(benzylamino)-1,1,1-trifluorobut-3-en-2-one (CAS 134219-70-8) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: (E)-4-(benzylamino)-1,1,1-trifluorobut-3-en-2-one. InChIKey: ZVATZGWONTYIIZ-VOTSOKGWSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | (E)-4-(benzylamino)-1,1,1-trifluorobut-3-en-2-one |
| InChIKey | ZVATZGWONTYIIZ-VOTSOKGWSA-N |
| SMILES | C1=CC=C(C=C1)CN/C=C/C(=O)C(F)(F)F |
Computed by PubChem (NCBI)