CAS 79066-90-3 is the registry number for 2,2,2-Trifluoro-1-(1,2,3,4-tetrahydroquinolin-1-yl)ethan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3,4-dihydro-2H-quinolin-1-yl)-2,2,2-trifluoroethanone (CAS 79066-90-3) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: 1-(3,4-dihydro-2H-quinolin-1-yl)-2,2,2-trifluoroethanone. InChIKey: XLGFUYHYKNMRQQ-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | 1-(3,4-dihydro-2H-quinolin-1-yl)-2,2,2-trifluoroethanone |
| InChIKey | XLGFUYHYKNMRQQ-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=CC=C2N(C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)