CAS 116836-28-3 appears in our catalog under these names: 8-Bromoquinolin-5-ol, 95%, 8-Bromoquinolin-5-ol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
8-bromoquinolin-5-ol (CAS 116836-28-3) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 8-bromoquinolin-5-ol. InChIKey: PQDUEAPSAXAQOY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 8-bromoquinolin-5-ol |
| InChIKey | PQDUEAPSAXAQOY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2N=C1)Br)O |
Computed by PubChem (NCBI)