Products 116850-34-1
CAS 116850-34-1 appears in our catalog under these names: 2-Fluoro-6-methylbenzotrifluoride, 95+%, 2-Fluoro-6-methylbenzotrifluoride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 250mg.
1-fluoro-3-methyl-2-(trifluoromethyl)benzene (CAS 116850-34-1) is a chemical compound with the molecular formula C8H6F4 and a molecular weight of 178.13 g/mol. IUPAC name: 1-fluoro-3-methyl-2-(trifluoromethyl)benzene. InChIKey: BDRSGTNFYVPJFJ-UHFFFAOYSA-N.
| Molecular formula | C8H6F4 |
|---|---|
| Molecular weight | 178.13 g/mol |
| IUPAC name | 1-fluoro-3-methyl-2-(trifluoromethyl)benzene |
| InChIKey | BDRSGTNFYVPJFJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)F)C(F)(F)F |
Computed by PubChem (NCBI)