CAS 116884-64-1 appears in our catalog under these names: 5-Amino-1-(4-methoxyphenyl)-1h-pyrazole-4-carbonitrile, 95%, 5-Amino-1-(4-methoxyphenyl)-1H-pyrazole-4-carbonitrile. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 2,5g.
5-amino-1-(4-methoxyphenyl)pyrazole-4-carbonitrile (CAS 116884-64-1) is a chemical compound with the molecular formula C11H10N4O and a molecular weight of 214.22 g/mol. IUPAC name: 5-amino-1-(4-methoxyphenyl)pyrazole-4-carbonitrile. InChIKey: AIQYZOPCGVEHML-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 5-amino-1-(4-methoxyphenyl)pyrazole-4-carbonitrile |
| InChIKey | AIQYZOPCGVEHML-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(=C(C=N2)C#N)N |
Computed by PubChem (NCBI)