Products 171863-96-0
CAS 171863-96-0 appears in our catalog under these names: Phenazopyridine Impurity 4, 6-Desamino-6-oxo Phenazopyridine. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
6-amino-5-phenyldiazenyl-1H-pyridin-2-one (CAS 171863-96-0) is a chemical compound with the molecular formula C11H10N4O and a molecular weight of 214.22 g/mol. IUPAC name: 6-amino-5-phenyldiazenyl-1H-pyridin-2-one. InChIKey: GGZOBYFDTVSUTM-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 6-amino-5-phenyldiazenyl-1H-pyridin-2-one |
| InChIKey | GGZOBYFDTVSUTM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=NC2=C(NC(=O)C=C2)N |
Computed by PubChem (NCBI)