CAS 1247175-07-0 is the registry number for N-((1H-Pyrazol-3-yl)methyl)benzo[d]oxazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1H-pyrazol-5-ylmethyl)-1,3-benzoxazol-2-amine (CAS 1247175-07-0) is a chemical compound with the molecular formula C11H10N4O and a molecular weight of 214.22 g/mol. IUPAC name: N-(1H-pyrazol-5-ylmethyl)-1,3-benzoxazol-2-amine. InChIKey: NGTAFDARCJNLEY-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | N-(1H-pyrazol-5-ylmethyl)-1,3-benzoxazol-2-amine |
| InChIKey | NGTAFDARCJNLEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)NCC3=CC=NN3 |
Computed by PubChem (NCBI)