Products 2417852-63-0
CAS 2417852-63-0 is the registry number for (1-Aminobenzo[4,5]imidazo[1,2-a]pyrazin-3-yl)methanol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol (CAS 2417852-63-0) is a chemical compound with the molecular formula C11H10N4O and a molecular weight of 214.22 g/mol. IUPAC name: (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol. InChIKey: WJRCPNMBNAPFCS-UHFFFAOYSA-N.
| Molecular formula | C11H10N4O |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | (1-aminopyrazino[1,2-a]benzimidazol-3-yl)methanol |
| InChIKey | WJRCPNMBNAPFCS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C3N2C=C(N=C3N)CO |
Computed by PubChem (NCBI)