CAS 116907-30-3 is the registry number for (2R,5R)-2-(1,1-Dimethylethyl)-5-phenyl-1,3-dioxolan-4-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
(2R,5R)-2-tert-butyl-5-phenyl-1,3-dioxolan-4-one (CAS 116907-30-3) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: (2R,5R)-2-tert-butyl-5-phenyl-1,3-dioxolan-4-one. InChIKey: ASTUNMYDURHXIM-ZYHUDNBSSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | (2R,5R)-2-tert-butyl-5-phenyl-1,3-dioxolan-4-one |
| InChIKey | ASTUNMYDURHXIM-ZYHUDNBSSA-N |
| SMILES | CC(C)(C)[C@@H]1O[C@@H](C(=O)O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)