CAS 81036-97-7 appears in our catalog under these names: (2S,5S)-2-(Tert-butyl)-5-phenyl-1,3-dioxolan-4-one, 98%, 98%, (2S,5S)-2-(tert-Butyl)-5-phenyl-1,3-dioxolan-4-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg.
(2S,5S)-2-tert-butyl-5-phenyl-1,3-dioxolan-4-one (CAS 81036-97-7) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: (2S,5S)-2-tert-butyl-5-phenyl-1,3-dioxolan-4-one. InChIKey: ASTUNMYDURHXIM-JQWIXIFHSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | (2S,5S)-2-tert-butyl-5-phenyl-1,3-dioxolan-4-one |
| InChIKey | ASTUNMYDURHXIM-JQWIXIFHSA-N |
| SMILES | CC(C)(C)[C@H]1O[C@H](C(=O)O1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)