Products 116939-86-7
CAS 116939-86-7 is the registry number for Z-Leu-Pro-OH·CHA. Offered by: Biosynth. Available pack sizes: 10g, 25g, 50g.
(2S)-1-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carboxylic acid (CAS 116939-86-7) is a chemical compound with the molecular formula C19H26N2O5 and a molecular weight of 362.4 g/mol. IUPAC name: (2S)-1-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carboxylic acid. InChIKey: WIMACFFGMDFEAP-HOTGVXAUSA-N.
| Molecular formula | C19H26N2O5 |
|---|---|
| Molecular weight | 362.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | WIMACFFGMDFEAP-HOTGVXAUSA-N |
| SMILES | CC(C)C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)