Products 117-62-4
CAS 117-62-4 appears in our catalog under these names: 2-Amino-1,5-naphthalenedisulfonic acid, 98%, 2-Amino-1,5-naphthalenedisulfonic acid 95% （xhydrate）, 2-Amino-1,5-naphthalenedisulfonic acid, 95% （xhydrate）, 95% （xhydrate）, 2-Amino-1,5-naphthalenedisulfonic acid, 95%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 500g, 1000g, 1kg.
2-aminonaphthalene-1,5-disulfonic acid (CAS 117-62-4) is a chemical compound with the molecular formula C10H9NO6S2 and a molecular weight of 303.3 g/mol. IUPAC name: 2-aminonaphthalene-1,5-disulfonic acid. InChIKey: YAIKCRUPEVOINQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6S2 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 2-aminonaphthalene-1,5-disulfonic acid |
| InChIKey | YAIKCRUPEVOINQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2S(=O)(=O)O)N)C(=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Amino-1,5-naphthalenedisulfonic acid, 2-Naphthylamine-1,5-disulfonic acid, Tobias acid, 5-sulfo-, 2-Amino-1,5-naphthalene disulfonic acid, 2-Aminonaphthalene-1,5-disulphonic acid, Kyselina sulfo-tobiasova [Czech], Kyselina sulfo-tobiasova, Kyselina 2-naftylamin-1,5-disulfonova, SULFOTOBIAS ACID, Kyselina 2-naftylamin-1,5-disulfonova [Czech]