Products 86-65-7
CAS 86-65-7 appears in our catalog under these names: 7-Amino-1,3-naphthalenedisulfonic Acid, 7-Amino-1,3-naphthalenedisulfonic acid, tech.. Offered by: TRC, Thermo Scientific (Acros). Available pack sizes: 250mg, 2.5KG, 100g, 500g.
7-aminonaphthalene-1,3-disulfonic acid (CAS 86-65-7) is a chemical compound with the molecular formula C10H9NO6S2 and a molecular weight of 303.3 g/mol. IUPAC name: 7-aminonaphthalene-1,3-disulfonic acid. InChIKey: CMOLPZZVECHXKN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6S2 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 7-aminonaphthalene-1,3-disulfonic acid |
| InChIKey | CMOLPZZVECHXKN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)S(=O)(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
7-aminonaphthalene-1,3-disulfonic acid, 7-Amino-1,3-naphthalenedisulfonic acid, Amido-G-acid, Amino-G-Acid, 1,3-Naphthalenedisulfonic acid, 7-amino-, 2-Amino-6,8-disulfonaphthalene, beta-Naphthylamine-6,8-disulfonic acid, 2-Aminonaphthalene-6,8-disulfonic acid, 7-Amino-1,3-naphthalenedisulfonic acid, tech., .beta.-Naphthylamine-6,8-disulfonic acid