Products 129-91-9
CAS 129-91-9 appears in our catalog under these names: 8-Aminonaphthalene-1,6-disulfonic acid, 95%, 8-Aminonaphthalene-1,6-disulfonic acid, 70.00%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100g.
8-aminonaphthalene-1,6-disulfonic acid (CAS 129-91-9) is a chemical compound with the molecular formula C10H9NO6S2 and a molecular weight of 303.3 g/mol. IUPAC name: 8-aminonaphthalene-1,6-disulfonic acid. InChIKey: YDEOXZHCPCPPJG-UHFFFAOYSA-N.
| Molecular formula | C10H9NO6S2 |
|---|---|
| Molecular weight | 303.3 g/mol |
| IUPAC name | 8-aminonaphthalene-1,6-disulfonic acid |
| InChIKey | YDEOXZHCPCPPJG-UHFFFAOYSA-N |
| SMILES | C1=CC2=CC(=CC(=C2C(=C1)S(=O)(=O)O)N)S(=O)(=O)O |
Computed by PubChem (NCBI)
Synonyms:
8-Amino-1,6-naphthalenedisulfonic acid, Aminoepsilon acid, 1,6-Naphthalenedisulfonic acid, 8-amino-, 1-Amino-3,8-disulfonaphthalene, 1-Naphthylamine-3,8-disulfonic acid, 1-Naphthylamine, 3,8-disulfo-, 8-Aminonaphthalene-1,6-disulfonic acid, Epsilon acid, 8-Aminonaphthalene-1,6-disulphonic acid, 8-amino-1,6-naphthalenedisulfonic acid sodium salt