Products 131-27-1

CAS 131-27-1 appears in our catalog under these names: 3-Aminonaphthalene-1,5-disulfonic acid 95+%, 3-Aminonaphthalene-1,5-disulfonic acid, 95+%, 95+%, 2-Amino-4,8-naphthalenedisulfonic acid. Offered by: Ambeed, Chemat, HPC Standards. Available pack sizes: 25g, 100g, 500g, 1x100mg.

Structural formula: {0} (CAS {1})

3-aminonaphthalene-1,5-disulfonic acid (CAS 131-27-1) is a chemical compound with the molecular formula C10H9NO6S2 and a molecular weight of 303.3 g/mol. IUPAC name: 3-aminonaphthalene-1,5-disulfonic acid. InChIKey: MTJGVAJYTOXFJH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO6S2
Molecular weight303.3 g/mol
IUPAC name3-aminonaphthalene-1,5-disulfonic acid
InChIKeyMTJGVAJYTOXFJH-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C(C=C2S(=O)(=O)O)N)C(=C1)S(=O)(=O)O

Computed by PubChem (NCBI)