CAS 1170-76-9 appears in our catalog under these names: Z-Gly-Phe-OH, 97%, N-[(Benzyloxy)carbonyl]glycylphenylalanine, 95%, Z–Gly–Phe–OH, Z-Gly-Phe, Cbz-Gly-Phe-OH 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 25g, 0,1g, 250mg, 10g, 100mg.
(2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoic acid (CAS 1170-76-9) is a chemical compound with the molecular formula C19H20N2O5 and a molecular weight of 356.4 g/mol. IUPAC name: (2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoic acid. InChIKey: FLGYJBNDDWLTQR-INIZCTEOSA-N.
| Molecular formula | C19H20N2O5 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2S)-3-phenyl-2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]propanoic acid |
| InChIKey | FLGYJBNDDWLTQR-INIZCTEOSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)O)NC(=O)CNC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)