Products 1418095-11-0
CAS 1418095-11-0 appears in our catalog under these names: Dimoxystrobin-5-benzoic acid, Dimoxystrobin Metabolite M505F009. Offered by: Dr. Ehrenstorfer, Biosynth, HPC Standards. Available pack sizes: 10mg, 100mg, 50mg, 1x10mg.
3-[[2-[(E)-N-methoxy-C-(methylcarbamoyl)carbonimidoyl]phenyl]methoxy]-4-methylbenzoic acid (CAS 1418095-11-0) is a chemical compound with the molecular formula C19H20N2O5 and a molecular weight of 356.4 g/mol. IUPAC name: 3-[[2-[(E)-N-methoxy-C-(methylcarbamoyl)carbonimidoyl]phenyl]methoxy]-4-methylbenzoic acid. InChIKey: RKECPZYSBKSRJM-HEHNFIMWSA-N.
| Molecular formula | C19H20N2O5 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | 3-[[2-[(E)-N-methoxy-C-(methylcarbamoyl)carbonimidoyl]phenyl]methoxy]-4-methylbenzoic acid |
| InChIKey | RKECPZYSBKSRJM-HEHNFIMWSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)OCC2=CC=CC=C2/C(=N\OC)/C(=O)NC |
Computed by PubChem (NCBI)