Products 851429-73-7
CAS 851429-73-7 is the registry number for N-Benzoyl-L-tyrosyl-L-alanine-1-13C. Offered by: TRC. Available pack sizes: 10mg.
(2S)-2-[[(2S)-2-benzamido-3-(4-hydroxyphenyl)propanoyl]amino](113C)propanoic acid (CAS 851429-73-7) is a chemical compound with the molecular formula C19H20N2O5 and a molecular weight of 357.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-benzamido-3-(4-hydroxyphenyl)propanoyl]amino](113C)propanoic acid. InChIKey: PSRCBRUPIDLBSA-WOFBRIANSA-N.
| Molecular formula | C19H20N2O5 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-benzamido-3-(4-hydroxyphenyl)propanoyl]amino](113C)propanoic acid |
| InChIKey | PSRCBRUPIDLBSA-WOFBRIANSA-N |
| SMILES | C[C@@H]([13C](=O)O)NC(=O)[C@H](CC1=CC=C(C=C1)O)NC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)