CAS 83803-17-2 appears in our catalog under these names: FA-Phe-Ala-OH, FA–Phe–Ala–OH. Offered by: Creative Peptides, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1g, 250mg, 500mg, 1000mg, Get quote.
(2S)-2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]propanoic acid (CAS 83803-17-2) is a chemical compound with the molecular formula C19H20N2O5 and a molecular weight of 356.4 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]propanoic acid. InChIKey: NOTCFISCFHKOHX-AULVFQMTSA-N.
| Molecular formula | C19H20N2O5 |
|---|---|
| Molecular weight | 356.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-3-phenylpropanoyl]amino]propanoic acid |
| InChIKey | NOTCFISCFHKOHX-AULVFQMTSA-N |
| SMILES | C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CC=CC=C1)NC(=O)/C=C/C2=CC=CO2 |
Computed by PubChem (NCBI)