CAS 1170006-49-1 is the registry number for N-(1,1-Dioxidotetrahydrothiophen-3-yl)-2-(methylamino)acetamide hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride (CAS 1170006-49-1) is a chemical compound with the molecular formula C7H15ClN2O3S and a molecular weight of 242.72 g/mol. IUPAC name: N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride. InChIKey: NPGYQYGJZBDLOZ-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN2O3S |
|---|---|
| Molecular weight | 242.72 g/mol |
| IUPAC name | N-(1,1-dioxothiolan-3-yl)-2-(methylamino)acetamide;hydrochloride |
| InChIKey | NPGYQYGJZBDLOZ-UHFFFAOYSA-N |
| SMILES | CNCC(=O)NC1CCS(=O)(=O)C1.Cl |
Computed by PubChem (NCBI)