CAS 1172392-16-3 is the registry number for 3-Amino-N-(1,1-dioxidotetrahydrothiophen-3-yl)propanamide hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
3-amino-N-(1,1-dioxothiolan-3-yl)propanamide;hydrochloride (CAS 1172392-16-3) is a chemical compound with the molecular formula C7H15ClN2O3S and a molecular weight of 242.72 g/mol. IUPAC name: 3-amino-N-(1,1-dioxothiolan-3-yl)propanamide;hydrochloride. InChIKey: VMTAVJWTMULWEU-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN2O3S |
|---|---|
| Molecular weight | 242.72 g/mol |
| IUPAC name | 3-amino-N-(1,1-dioxothiolan-3-yl)propanamide;hydrochloride |
| InChIKey | VMTAVJWTMULWEU-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CC1NC(=O)CCN.Cl |
Computed by PubChem (NCBI)