CAS 1251922-66-3 is the registry number for 2-amino-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one,hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-amino-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one;hydrochloride (CAS 1251922-66-3) is a chemical compound with the molecular formula C7H15ClN2O3S and a molecular weight of 242.72 g/mol. IUPAC name: 2-amino-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one;hydrochloride. InChIKey: YILXRMFDCIDGQN-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN2O3S |
|---|---|
| Molecular weight | 242.72 g/mol |
| IUPAC name | 2-amino-1-(1,1-dioxo-1,4-thiazinan-4-yl)propan-1-one;hydrochloride |
| InChIKey | YILXRMFDCIDGQN-UHFFFAOYSA-N |
| SMILES | CC(C(=O)N1CCS(=O)(=O)CC1)N.Cl |
Computed by PubChem (NCBI)