CAS 1955540-13-2 appears in our catalog under these names: 2-(1,1-Dioxidothiomorpholin-3-yl)-N-methylacetamide hydrochloride, 95%, 2-(1,1-Dioxo-1λâ¶-thiomorpholin-3-yl)-N-methylacetamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-methylacetamide;hydrochloride (CAS 1955540-13-2) is a chemical compound with the molecular formula C7H15ClN2O3S and a molecular weight of 242.72 g/mol. IUPAC name: 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-methylacetamide;hydrochloride. InChIKey: RLLBBKYHSBJPPR-UHFFFAOYSA-N.
| Molecular formula | C7H15ClN2O3S |
|---|---|
| Molecular weight | 242.72 g/mol |
| IUPAC name | 2-(1,1-dioxo-1,4-thiazinan-3-yl)-N-methylacetamide;hydrochloride |
| InChIKey | RLLBBKYHSBJPPR-UHFFFAOYSA-N |
| SMILES | CNC(=O)CC1CS(=O)(=O)CCN1.Cl |
Computed by PubChem (NCBI)