CAS 1170128-33-2 appears in our catalog under these names: 1-(2-Chlorophenyl)-2-piperazin-1-ylethanone dihydrochloride, 95%, 1-(2-Chlorophenyl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride, 1-(2-Chlorophenyl)-2-(piperazin-1-yl)ethan-1-one dihydrochloride, 98%. Offered by: Combi-blocks, Biosynth, AmBeed. Available pack sizes: 5g, 250mg, 100mg, 1g.
1-(2-chlorophenyl)-2-piperazin-1-ylethanone;dihydrochloride (CAS 1170128-33-2) is a chemical compound with the molecular formula C12H17Cl3N2O and a molecular weight of 311.6 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-piperazin-1-ylethanone;dihydrochloride. InChIKey: XODFOHBXWWFTLQ-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl3N2O |
|---|---|
| Molecular weight | 311.6 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-piperazin-1-ylethanone;dihydrochloride |
| InChIKey | XODFOHBXWWFTLQ-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC(=O)C2=CC=CC=C2Cl.Cl.Cl |
Computed by PubChem (NCBI)