CAS 37845-71-9 appears in our catalog under these names: Clenbuterol EP Impurity B HCl, Clenbuterol Impurity 2(Clenbuterol EP Impurity B), Clenbuterol EP Impurity B, 1-(4-Amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanone hydrochloride, 95%, 95%, Clenbuterol impurity 1, 98.26%. Offered by: Chemat Brand, Hubei YoungXin, Chemat, MedChemExpress, Fluorochem. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 500mg.
1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanone;hydrochloride (CAS 37845-71-9) is a chemical compound with the molecular formula C12H17Cl3N2O and a molecular weight of 311.6 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanone;hydrochloride. InChIKey: VCMBTLCRANMPCO-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl3N2O |
|---|---|
| Molecular weight | 311.6 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanone;hydrochloride |
| InChIKey | VCMBTLCRANMPCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C(=C1)Cl)N)Cl.Cl |
Computed by PubChem (NCBI)