CAS 401509-33-9 is the registry number for 1-[2-(2,4-Dichlorophenoxy)ethyl]piperazine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[2-(2,4-dichlorophenoxy)ethyl]piperazine;hydrochloride (CAS 401509-33-9) is a chemical compound with the molecular formula C12H17Cl3N2O and a molecular weight of 311.6 g/mol. IUPAC name: 1-[2-(2,4-dichlorophenoxy)ethyl]piperazine;hydrochloride. InChIKey: WDOREYKBCRZLNE-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl3N2O |
|---|---|
| Molecular weight | 311.6 g/mol |
| IUPAC name | 1-[2-(2,4-dichlorophenoxy)ethyl]piperazine;hydrochloride |
| InChIKey | WDOREYKBCRZLNE-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CCOC2=C(C=C(C=C2)Cl)Cl.Cl |
Computed by PubChem (NCBI)