CAS 37148-49-5 appears in our catalog under these names: 1-(4-Amino-3,5-dichlorophenyl)-2-((1,1-dimethylethyl)amino)ethanone Hydrochloride, Clenbuterol EP Impurity B. Offered by: Mikromol, Chemat Brand. Available pack sizes: 25mg, 100mg, on request.
1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanone;hydrochloride (CAS 37148-49-5) is a chemical compound with the molecular formula C12H17Cl3N2O and a molecular weight of 311.6 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanone;hydrochloride. InChIKey: VCMBTLCRANMPCO-UHFFFAOYSA-N.
| Molecular formula | C12H17Cl3N2O |
|---|---|
| Molecular weight | 311.6 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-(tert-butylamino)ethanone;hydrochloride |
| InChIKey | VCMBTLCRANMPCO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NCC(=O)C1=CC(=C(C(=C1)Cl)N)Cl.Cl |
Computed by PubChem (NCBI)