CAS 1170249-44-1 appears in our catalog under these names: 3,3-Dimethyl-7-nitro-2,3-dihydrobenzo[b][1,4]oxazepin-4(5h)-one, 95%, 95%, 3,3-Dimethyl-7-nitro-2,3-dihydrobenzo[b][1,4]oxazepin-4(5h)-one, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 2.5g, 10g.
3,3-dimethyl-7-nitro-2,5-dihydro-1,5-benzoxazepin-4-one (CAS 1170249-44-1) is a chemical compound with the molecular formula C11H12N2O4 and a molecular weight of 236.22 g/mol. IUPAC name: 3,3-dimethyl-7-nitro-2,5-dihydro-1,5-benzoxazepin-4-one. InChIKey: FOMIYORDGVQVOP-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O4 |
|---|---|
| Molecular weight | 236.22 g/mol |
| IUPAC name | 3,3-dimethyl-7-nitro-2,5-dihydro-1,5-benzoxazepin-4-one |
| InChIKey | FOMIYORDGVQVOP-UHFFFAOYSA-N |
| SMILES | CC1(COC2=C(C=C(C=C2)[N+](=O)[O-])NC1=O)C |
Computed by PubChem (NCBI)