CAS 1170288-04-6 appears in our catalog under these names: 2-(3,4-Dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride, 95%, 2-(3,4-Dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride (CAS 1170288-04-6) is a chemical compound with the molecular formula C13H14ClNO4S and a molecular weight of 315.77 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride. InChIKey: IOGVLOURIDAQJD-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO4S |
|---|---|
| Molecular weight | 315.77 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid;hydrochloride |
| InChIKey | IOGVLOURIDAQJD-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)C2=CC(=C(C=C2)OC)OC)C(=O)O.Cl |
Computed by PubChem (NCBI)