CAS 872983-77-2 is the registry number for tert-Butyl 2-(chlorosulfonyl)-1H-indole-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 2-chlorosulfonylindole-1-carboxylate (CAS 872983-77-2) is a chemical compound with the molecular formula C13H14ClNO4S and a molecular weight of 315.77 g/mol. IUPAC name: tert-butyl 2-chlorosulfonylindole-1-carboxylate. InChIKey: SMXOBRJVBAHYLK-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO4S |
|---|---|
| Molecular weight | 315.77 g/mol |
| IUPAC name | tert-butyl 2-chlorosulfonylindole-1-carboxylate |
| InChIKey | SMXOBRJVBAHYLK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C2=CC=CC=C2C=C1S(=O)(=O)Cl |
Computed by PubChem (NCBI)